C28H30F3N5O5 — CID 90814632
(2S,3R)-N,3-dihydroxy-2-[1-[4-[2-[4-[[2-[(3R)-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]acetyl]amino]phenyl]ethynyl]phenyl]ethylideneamino]butanamide (PubChem CID 90814632) has the molecular formula C28H30F3N5O5 and a molecular weight of 573.57 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[1-[4-[2-[4-[[2-[(3R)-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]acetyl]amino]phenyl]ethynyl]phenyl]ethylideneamino]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[1-[4-[2-[4-[[2-[(3R)-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]acetyl]amino]phenyl]ethynyl]phenyl]ethylideneamino]butanamide |
|---|---|
| PubChem CID | 90814632 |
| Molecular Formula | C28H30F3N5O5 |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[1-[4-[2-[4-[[2-[(3R)-3-[(2,2,2-trifluoroacetyl)amino]pyrrolidin-1-yl]acetyl]amino]phenyl]ethynyl]phenyl]ethylideneamino]butanamide |
| SMILES | C/C(=N\[C@H](C(=O)NO)[C@@H](C)O)c1ccc(C#Cc2ccc(NC(=O)CN3CC[C@@H](NC(=O)C(F)(F)F)C3)cc2)cc1 |
| InChI | InChI=1S/C28H30F3N5O5/c1-17(32-25(18(2)37)26(39)35-41)21-9-5-19(6-10-21)3-4-20-7-11-22(12-8-20)33-24(38)16-36-14-13-23(15-36)34-27(40)28(29,30)31/h5-12,18,23,25,37,41H,13-16H2,1-2H3,(H,33,38)(H,34,40)(H,35,39)/b32-17+/t18-,23-,25+/m1/s1 |
| InChIKey | RINWHQRFDQBVHB-FJPZEVGFSA-N |
| XLogP | 1.84 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|