C22H25N7O5S — CID 90817483
1-(4,4a,5,6-tetrahydro-3H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)-4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-N-methylpiperazine-2-carboxamide (PubChem CID 90817483) has the molecular formula C22H25N7O5S and a molecular weight of 499.55 g/mol. Its IUPAC name is 1-(4,4a,5,6-tetrahydro-3H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)-4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-N-methylpiperazine-2-carboxamide.
| Compound Name | 1-(4,4a,5,6-tetrahydro-3H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)-4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-N-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 90817483 |
| Molecular Formula | C22H25N7O5S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 1-(4,4a,5,6-tetrahydro-3H-[1,3]oxazolo[5,4-c]pyridazine-2-carbonyl)-4-[(5-ethynyl-1H-indol-2-yl)sulfonyl]-N-methylpiperazine-2-carboxamide |
| SMILES | C#Cc1ccc2[nH]c(S(=O)(=O)N3CCN(C(=O)N4CCC5NCOC5=N4)C(C(=O)NC)C3)cc2c1 |
| InChI | InChI=1S/C22H25N7O5S/c1-3-14-4-5-16-15(10-14)11-19(25-16)35(32,33)27-8-9-28(18(12-27)20(30)23-2)22(31)29-7-6-17-21(26-29)34-13-24-17/h1,4-5,10-11,17-18,24-25H,6-9,12-13H2,2H3,(H,23,30) |
| InChIKey | INYOVQHGPAKYIL-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|