C19H24N2O3 — CID 90819147
2-benzyl-5-morpholin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 90819147) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-benzyl-5-morpholin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-benzyl-5-morpholin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 90819147 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-benzyl-5-morpholin-4-yl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1Cc1ccccc1)CC(N1CCOCC1)CC2 |
| InChI | InChI=1S/C19H24N2O3/c22-18-16-7-6-15(20-8-10-24-11-9-20)12-17(16)19(23)21(18)13-14-4-2-1-3-5-14/h1-5,15,22-23H,6-13H2 |
| InChIKey | LRGPDZVRGIIULG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |