C20H20F3NO3S — CID 90820151
2-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one (PubChem CID 90820151) has the molecular formula C20H20F3NO3S and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one.
| Compound Name | 2-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 90820151 |
| Molecular Formula | C20H20F3NO3S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-(2-phenylethyl)-1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-one |
| SMILES | O=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)C(CCc2ccccc2)C1 |
| InChI | InChI=1S/C20H20F3NO3S/c21-20(22,23)16-7-4-8-19(13-16)28(26,27)24-12-11-18(25)14-17(24)10-9-15-5-2-1-3-6-15/h1-8,13,17H,9-12,14H2 |
| InChIKey | ZEWWZNCRZGICKJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |