C14H21NO5 — CID 90820181
2-oxopropyl 2-[(3,3-dimethyl-2-oxobutanoyl)amino]pent-3-enoate (PubChem CID 90820181) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-oxopropyl 2-[(3,3-dimethyl-2-oxobutanoyl)amino]pent-3-enoate.
| Compound Name | 2-oxopropyl 2-[(3,3-dimethyl-2-oxobutanoyl)amino]pent-3-enoate |
|---|---|
| PubChem CID | 90820181 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-oxopropyl 2-[(3,3-dimethyl-2-oxobutanoyl)amino]pent-3-enoate |
| SMILES | CC=CC(NC(=O)C(=O)C(C)(C)C)C(=O)OCC(C)=O |
| InChI | InChI=1S/C14H21NO5/c1-6-7-10(13(19)20-8-9(2)16)15-12(18)11(17)14(3,4)5/h6-7,10H,8H2,1-5H3,(H,15,18) |
| InChIKey | VGZWQSAPPAFFGR-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|