C19H29NO5 — CID 90824163
[3-amino-1-(3,4-dihydroxyphenyl)-5,5-dimethyl-4-oxohexan-2-yl] 2,2-dimethylpropanoate (PubChem CID 90824163) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is [3-amino-1-(3,4-dihydroxyphenyl)-5,5-dimethyl-4-oxohexan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-amino-1-(3,4-dihydroxyphenyl)-5,5-dimethyl-4-oxohexan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90824163 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [3-amino-1-(3,4-dihydroxyphenyl)-5,5-dimethyl-4-oxohexan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(Cc1ccc(O)c(O)c1)C(N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H29NO5/c1-18(2,3)16(23)15(20)14(25-17(24)19(4,5)6)10-11-7-8-12(21)13(22)9-11/h7-9,14-15,21-22H,10,20H2,1-6H3 |
| InChIKey | JDHSROVJJHLONF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|