C26H41F3O4Si — CID 90828620
[2-hydroxy-2-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tetramethylsilane (PubChem CID 90828620) has the molecular formula C26H41F3O4Si and a molecular weight of 502.69 g/mol. Its IUPAC name is [2-hydroxy-2-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tetramethylsilane.
| Compound Name | [2-hydroxy-2-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tetramethylsilane |
|---|---|
| PubChem CID | 90828620 |
| Molecular Formula | C26H41F3O4Si |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | [2-hydroxy-2-(trifluoromethyl)-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;tetramethylsilane |
| SMILES | C[Si](C)(C)C.O=C(OC12CCCCC1OC(O)(C(F)(F)F)C2)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C22H29F3O4.C4H12Si/c23-22(24,25)21(27)10-20(6-2-1-3-16(20)28-21)29-19(26)15-9-13-8-14(15)18-12-5-4-11(7-12)17(13)18;1-5(2,3)4/h11-18,27H,1-10H2;1-4H3 |
| InChIKey | XLWWLTUFTRGICL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|