C22H23N5O — CID 90831433
1-(3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-5-(6-methyl-1H-benzimidazol-2-yl)pentan-1-one (PubChem CID 90831433) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-5-(6-methyl-1H-benzimidazol-2-yl)pentan-1-one.
| Compound Name | 1-(3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-5-(6-methyl-1H-benzimidazol-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 90831433 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-(3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyridin-8-yl)-5-(6-methyl-1H-benzimidazol-2-yl)pentan-1-one |
| SMILES | Cc1ccc2nc(CCCCC(=O)c3cccn4c(C5CC5)nnc34)[nH]c2c1 |
| InChI | InChI=1S/C22H23N5O/c1-14-8-11-17-18(13-14)24-20(23-17)7-3-2-6-19(28)16-5-4-12-27-21(15-9-10-15)25-26-22(16)27/h4-5,8,11-13,15H,2-3,6-7,9-10H2,1H3,(H,23,24) |
| InChIKey | AZOGUCLUIUSDFL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|