C20H22N2O5 — CID 90832106
(1S,7S)-4-(4-tert-butyl-3-nitrophenyl)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one (PubChem CID 90832106) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (1S,7S)-4-(4-tert-butyl-3-nitrophenyl)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one.
| Compound Name | (1S,7S)-4-(4-tert-butyl-3-nitrophenyl)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one |
|---|---|
| PubChem CID | 90832106 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (1S,7S)-4-(4-tert-butyl-3-nitrophenyl)-3,5-dihydroxy-4-azatricyclo[5.2.2.02,6]undeca-2,5-dien-8-one |
| SMILES | CC(C)(C)c1ccc(-n2c(O)c3c(c2O)[C@@H]2CC[C@H]3CC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N2O5/c1-20(2,3)13-7-5-11(9-14(13)22(26)27)21-18(24)16-10-4-6-12(15(23)8-10)17(16)19(21)25/h5,7,9-10,12,24-25H,4,6,8H2,1-3H3/t10-,12+/m0/s1 |
| InChIKey | KXZSHHFJFZGQST-CMPLNLGQSA-N |
| XLogP | 4.03 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|