C21H24N2O4 — CID 91364584
(1R,7S,8S,10R)-4-(4-tert-butyl-3-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol (PubChem CID 91364584) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (1R,7S,8S,10R)-4-(4-tert-butyl-3-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol.
| Compound Name | (1R,7S,8S,10R)-4-(4-tert-butyl-3-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 91364584 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (1R,7S,8S,10R)-4-(4-tert-butyl-3-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
| SMILES | CC(C)(C)c1ccc(-n2c(O)c3c(c2O)[C@@H]2CC[C@H]3[C@H]3C[C@H]32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O4/c1-21(2,3)15-7-4-10(8-16(15)23(26)27)22-19(24)17-11-5-6-12(14-9-13(11)14)18(17)20(22)25/h4,7-8,11-14,24-25H,5-6,9H2,1-3H3/t11-,12+,13+,14- |
| InChIKey | DRMPNTYYXAKHTQ-LVEBTZEWSA-N |
| XLogP | 4.70 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|