C22H17F3N2O4 — CID 91573049
(1R,7R,8R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (PubChem CID 91573049) has the molecular formula C22H17F3N2O4 and a molecular weight of 430.38 g/mol. Its IUPAC name is (1R,7R,8R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
| Compound Name | (1R,7R,8R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 91573049 |
| Molecular Formula | C22H17F3N2O4 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (1R,7R,8R)-4-[4-nitro-3-(trifluoromethyl)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
| SMILES | O=[N+]([O-])c1ccc(-n2c(O)c3c(c2O)[C@@H]2C[C@H]3C[C@H]2c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H17F3N2O4/c23-22(24,25)16-10-13(6-7-17(16)27(30)31)26-20(28)18-12-8-14(11-4-2-1-3-5-11)15(9-12)19(18)21(26)29/h1-7,10,12,14-15,28-29H,8-9H2/t12-,14+,15-/m1/s1 |
| InChIKey | JCKZXPTUWWURDR-VHDGCEQUSA-N |
| XLogP | 5.57 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|