C22H23NO7S — CID 90836427
[(1R,5S)-4-[(R)-benzenesulfonyl(nitro)methyl]-5-(phenylmethoxymethyl)cyclopent-2-en-1-yl] acetate (PubChem CID 90836427) has the molecular formula C22H23NO7S and a molecular weight of 445.49 g/mol. Its IUPAC name is [(1R,5S)-4-[(R)-benzenesulfonyl(nitro)methyl]-5-(phenylmethoxymethyl)cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,5S)-4-[(R)-benzenesulfonyl(nitro)methyl]-5-(phenylmethoxymethyl)cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 90836427 |
| Molecular Formula | C22H23NO7S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [(1R,5S)-4-[(R)-benzenesulfonyl(nitro)methyl]-5-(phenylmethoxymethyl)cyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CC([C@H]([N+](=O)[O-])S(=O)(=O)c2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C22H23NO7S/c1-16(24)30-21-13-12-19(20(21)15-29-14-17-8-4-2-5-9-17)22(23(25)26)31(27,28)18-10-6-3-7-11-18/h2-13,19-22H,14-15H2,1H3/t19?,20-,21-,22-/m1/s1 |
| InChIKey | UBSDAACLPUWMDT-QPVBMBBTSA-N |
| XLogP | 3.01 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|