C21H26N2O5 — CID 9084168
butyl 4-[[2-(2,5-dimethoxyanilino)-2-oxoethyl]amino]benzoate (PubChem CID 9084168) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is butyl 4-[[2-(2,5-dimethoxyanilino)-2-oxoethyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(2,5-dimethoxyanilino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 9084168 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | butyl 4-[[2-(2,5-dimethoxyanilino)-2-oxoethyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NCC(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-4-5-12-28-21(25)15-6-8-16(9-7-15)22-14-20(24)23-18-13-17(26-2)10-11-19(18)27-3/h6-11,13,22H,4-5,12,14H2,1-3H3,(H,23,24) |
| InChIKey | MHLODRHZPIAAHC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|