C14H12BrClN2OS — CID 90843127
1-[[4-bromo-5-(3-chlorophenyl)thiophen-2-yl]methyl]imidazolidin-4-one (PubChem CID 90843127) has the molecular formula C14H12BrClN2OS and a molecular weight of 371.69 g/mol. Its IUPAC name is 1-[[4-bromo-5-(3-chlorophenyl)thiophen-2-yl]methyl]imidazolidin-4-one.
| Compound Name | 1-[[4-bromo-5-(3-chlorophenyl)thiophen-2-yl]methyl]imidazolidin-4-one |
|---|---|
| PubChem CID | 90843127 |
| Molecular Formula | C14H12BrClN2OS |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 1-[[4-bromo-5-(3-chlorophenyl)thiophen-2-yl]methyl]imidazolidin-4-one |
| SMILES | O=C1CN(Cc2cc(Br)c(-c3cccc(Cl)c3)s2)CN1 |
| InChI | InChI=1S/C14H12BrClN2OS/c15-12-5-11(6-18-7-13(19)17-8-18)20-14(12)9-2-1-3-10(16)4-9/h1-5H,6-8H2,(H,17,19) |
| InChIKey | YXDPIPYPVIYTDS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |