C13H15NO5 — CID 90849042
2-benzyl-3-methyl-1,2-oxazolidine-4,5-dicarboxylic acid (PubChem CID 90849042) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-benzyl-3-methyl-1,2-oxazolidine-4,5-dicarboxylic acid.
| Compound Name | 2-benzyl-3-methyl-1,2-oxazolidine-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 90849042 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-benzyl-3-methyl-1,2-oxazolidine-4,5-dicarboxylic acid |
| SMILES | CC1C(C(=O)O)C(C(=O)O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO5/c1-8-10(12(15)16)11(13(17)18)19-14(8)7-9-5-3-2-4-6-9/h2-6,8,10-11H,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | MHZORESSPKXYHQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |