C10H7N5O3 — CID 90849315
4-methoxy-2-(2H-tetrazol-5-yl)isoindole-1,3-dione (PubChem CID 90849315) has the molecular formula C10H7N5O3 and a molecular weight of 245.20 g/mol. Its IUPAC name is 4-methoxy-2-(2H-tetrazol-5-yl)isoindole-1,3-dione.
| Compound Name | 4-methoxy-2-(2H-tetrazol-5-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 90849315 |
| Molecular Formula | C10H7N5O3 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 4-methoxy-2-(2H-tetrazol-5-yl)isoindole-1,3-dione |
| SMILES | COc1cccc2c1C(=O)N(c1nn[nH]n1)C2=O |
| InChI | InChI=1S/C10H7N5O3/c1-18-6-4-2-3-5-7(6)9(17)15(8(5)16)10-11-13-14-12-10/h2-4H,1H3,(H,11,12,13,14) |
| InChIKey | BFHHNUCIPWSCBT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|