C33H24N6O12 — CID 20721736
2-[4,6-bis(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-1,3,5-triazin-2-yl]-5,6-dimethoxyisoindole-1,3-dione (PubChem CID 20721736) has the molecular formula C33H24N6O12 and a molecular weight of 696.59 g/mol. Its IUPAC name is 2-[4,6-bis(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-1,3,5-triazin-2-yl]-5,6-dimethoxyisoindole-1,3-dione.
| Compound Name | 2-[4,6-bis(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-1,3,5-triazin-2-yl]-5,6-dimethoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 20721736 |
| Molecular Formula | C33H24N6O12 |
| Molecular Weight | 696.59 g/mol |
| Exact Mass | 696.15 |
| IUPAC Name | 2-[4,6-bis(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-1,3,5-triazin-2-yl]-5,6-dimethoxyisoindole-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)N(c1nc(N3C(=O)c4cc(OC)c(OC)cc4C3=O)nc(N3C(=O)c4cc(OC)c(OC)cc4C3=O)n1)C2=O |
| InChI | InChI=1S/C33H24N6O12/c1-46-19-7-13-14(8-20(19)47-2)26(41)37(25(13)40)31-34-32(38-27(42)15-9-21(48-3)22(49-4)10-16(15)28(38)43)36-33(35-31)39-29(44)17-11-23(50-5)24(51-6)12-18(17)30(39)45/h7-12H,1-6H3 |
| InChIKey | MBFVKGRCOVXYIN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 206.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|