C17H14ClNO7S — CID 101103561
4-(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride (PubChem CID 101103561) has the molecular formula C17H14ClNO7S and a molecular weight of 411.82 g/mol. Its IUPAC name is 4-(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride.
| Compound Name | 4-(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 101103561 |
| Molecular Formula | C17H14ClNO7S |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 4-(5,6-dimethoxy-1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride |
| SMILES | COc1cc2c(cc1OC)C(=O)N(c1ccc(S(=O)(=O)Cl)c(OC)c1)C2=O |
| InChI | InChI=1S/C17H14ClNO7S/c1-24-12-7-10-11(8-13(12)25-2)17(21)19(16(10)20)9-4-5-15(27(18,22)23)14(6-9)26-3/h4-8H,1-3H3 |
| InChIKey | CRCWVJZUUALQHE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|