C25H38O3Si — CID 90859093
tert-butyl-[3-[2-(methoxymethylidene)-1-adamantyl]-5-(trideuteriomethoxy)phenoxy]-dimethylsilane (PubChem CID 90859093) has the molecular formula C25H38O3Si and a molecular weight of 417.68 g/mol. Its IUPAC name is tert-butyl-[3-[2-(methoxymethylidene)-1-adamantyl]-5-(trideuteriomethoxy)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[2-(methoxymethylidene)-1-adamantyl]-5-(trideuteriomethoxy)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 90859093 |
| Molecular Formula | C25H38O3Si |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | tert-butyl-[3-[2-(methoxymethylidene)-1-adamantyl]-5-(trideuteriomethoxy)phenoxy]-dimethylsilane |
| SMILES | [2H]C([2H])([2H])Oc1cc(O[Si](C)(C)C(C)(C)C)cc(C23CC4CC(CC(C4)C2=COC)C3)c1 |
| InChI | InChI=1S/C25H38O3Si/c1-24(2,3)29(6,7)28-22-12-20(11-21(13-22)27-5)25-14-17-8-18(15-25)10-19(9-17)23(25)16-26-4/h11-13,16-19H,8-10,14-15H2,1-7H3/i5D3 |
| InChIKey | LGNKJBDYVWCFSK-VPYROQPTSA-N |
| XLogP | 6.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|