C26H19F7O — CID 90864239
2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methyl]phenyl]-3,5-difluorophenyl]-5-ethenyloxane (PubChem CID 90864239) has the molecular formula C26H19F7O and a molecular weight of 480.42 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methyl]phenyl]-3,5-difluorophenyl]-5-ethenyloxane.
| Compound Name | 2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methyl]phenyl]-3,5-difluorophenyl]-5-ethenyloxane |
|---|---|
| PubChem CID | 90864239 |
| Molecular Formula | C26H19F7O |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methyl]phenyl]-3,5-difluorophenyl]-5-ethenyloxane |
| SMILES | C=CC1CCC(c2cc(F)c(-c3cc(F)c(Cc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C26H19F7O/c1-2-13-3-4-24(34-12-13)15-8-20(29)25(21(30)9-15)16-10-18(27)17(19(28)11-16)5-14-6-22(31)26(33)23(32)7-14/h2,6-11,13,24H,1,3-5,12H2 |
| InChIKey | VTTMUDAGAWQYJH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|