C14H13BrF2 — CID 90866317
5'-bromo-4,4-difluorospiro[cyclohexane-1,2'-indene] (PubChem CID 90866317) has the molecular formula C14H13BrF2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 5'-bromo-4,4-difluorospiro[cyclohexane-1,2'-indene].
| Compound Name | 5'-bromo-4,4-difluorospiro[cyclohexane-1,2'-indene] |
|---|---|
| PubChem CID | 90866317 |
| Molecular Formula | C14H13BrF2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5'-bromo-4,4-difluorospiro[cyclohexane-1,2'-indene] |
| SMILES | FC1(F)CCC2(C=c3ccc(Br)cc3=C2)CC1 |
| InChI | InChI=1S/C14H13BrF2/c15-12-2-1-10-8-13(9-11(10)7-12)3-5-14(16,17)6-4-13/h1-2,7-9H,3-6H2 |
| InChIKey | KTNONAULQQMOFD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |