C10H20N- — CID 90870092
[(Z)-5,6-dimethylhept-2-en-3-yl]-methylazanide (PubChem CID 90870092) has the molecular formula C10H20N- and a molecular weight of 154.28 g/mol. Its IUPAC name is [(Z)-5,6-dimethylhept-2-en-3-yl]-methylazanide.
| Compound Name | [(Z)-5,6-dimethylhept-2-en-3-yl]-methylazanide |
|---|---|
| PubChem CID | 90870092 |
| Molecular Formula | C10H20N- |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.16 |
| IUPAC Name | [(Z)-5,6-dimethylhept-2-en-3-yl]-methylazanide |
| SMILES | C/C=C(/CC(C)C(C)C)[N-]C |
| InChI | InChI=1S/C10H20N/c1-6-10(11-5)7-9(4)8(2)3/h6,8-9H,7H2,1-5H3/q-1/b10-6- |
| InChIKey | LOFRILJUKVMKBW-POHAHGRESA-N |
| XLogP | 3.58 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |