C22H32F6O6 — CID 90874536
1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate (PubChem CID 90874536) has the molecular formula C22H32F6O6 and a molecular weight of 506.48 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90874536 |
| Molecular Formula | C22H32F6O6 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2,2-dimethylbutanoate;(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C(F)(F)F)C(F)(F)F.CCC(C)(C)C(=O)OC1C(=O)OC2CCCC21 |
| InChI | InChI=1S/C13H20O4.C9H12F6O2/c1-4-13(2,3)12(15)17-10-8-6-5-7-9(8)16-11(10)14;1-4-7(2,3)6(16)17-5(8(10,11)12)9(13,14)15/h8-10H,4-7H2,1-3H3;5H,4H2,1-3H3 |
| InChIKey | XWAMLILIQHJVNV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|