C14H14N4O4 — CID 90876376
(2,5-dihydroxypyrrol-1-yl) 4-(4-azidophenyl)butanoate (PubChem CID 90876376) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-(4-azidophenyl)butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-(4-azidophenyl)butanoate |
|---|---|
| PubChem CID | 90876376 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-(4-azidophenyl)butanoate |
| SMILES | [N-]=[N+]=Nc1ccc(CCCC(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C14H14N4O4/c15-17-16-11-6-4-10(5-7-11)2-1-3-14(21)22-18-12(19)8-9-13(18)20/h4-9,19-20H,1-3H2 |
| InChIKey | ZRCCMMMOQBVGEI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 120.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|