C8H6N2O2S — CID 90877373
1,4-dimethyl-2,6-dioxo-5-sulfanylidenepyridine-3-carbonitrile (PubChem CID 90877373) has the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. Its IUPAC name is 1,4-dimethyl-2,6-dioxo-5-sulfanylidenepyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-2,6-dioxo-5-sulfanylidenepyridine-3-carbonitrile |
|---|---|
| PubChem CID | 90877373 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 1,4-dimethyl-2,6-dioxo-5-sulfanylidenepyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)C1=S |
| InChI | InChI=1S/C8H6N2O2S/c1-4-5(3-9)7(11)10(2)8(12)6(4)13/h1-2H3 |
| InChIKey | OPQWTLURHOKJBQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|