C9H8N2O2S — CID 91105305
1,4-dimethyl-5-(methylidene-λ4-sulfanylidene)-2,6-dioxopyridine-3-carbonitrile (PubChem CID 91105305) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 1,4-dimethyl-5-(methylidene-λ4-sulfanylidene)-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 1,4-dimethyl-5-(methylidene-λ4-sulfanylidene)-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 91105305 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1,4-dimethyl-5-(methylidene-λ4-sulfanylidene)-2,6-dioxopyridine-3-carbonitrile |
| SMILES | C=S=C1C(=O)N(C)C(=O)C(C#N)=C1C |
| InChI | InChI=1S/C9H8N2O2S/c1-5-6(4-10)8(12)11(2)9(13)7(5)14-3/h3H2,1-2H3 |
| InChIKey | CHZXCBIYYKKCIC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|