C10H19NO2 — CID 90881390
N-(2-methoxyethyl)-3-methylhex-4-enamide (PubChem CID 90881390) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-methylhex-4-enamide.
| Compound Name | N-(2-methoxyethyl)-3-methylhex-4-enamide |
|---|---|
| PubChem CID | 90881390 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-(2-methoxyethyl)-3-methylhex-4-enamide |
| SMILES | CC=CC(C)CC(=O)NCCOC |
| InChI | InChI=1S/C10H19NO2/c1-4-5-9(2)8-10(12)11-6-7-13-3/h4-5,9H,6-8H2,1-3H3,(H,11,12) |
| InChIKey | UJNSTIUKXJOUKL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|