C25H54OSi2 — CID 90895750
2-(1,2-dimethyl-2-pentylsiletan-1-yl)oxybutan-2-yl-(4-ethyl-4-methylhexyl)-dimethylsilane (PubChem CID 90895750) has the molecular formula C25H54OSi2 and a molecular weight of 426.88 g/mol. Its IUPAC name is 2-(1,2-dimethyl-2-pentylsiletan-1-yl)oxybutan-2-yl-(4-ethyl-4-methylhexyl)-dimethylsilane.
| Compound Name | 2-(1,2-dimethyl-2-pentylsiletan-1-yl)oxybutan-2-yl-(4-ethyl-4-methylhexyl)-dimethylsilane |
|---|---|
| PubChem CID | 90895750 |
| Molecular Formula | C25H54OSi2 |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.37 |
| IUPAC Name | 2-(1,2-dimethyl-2-pentylsiletan-1-yl)oxybutan-2-yl-(4-ethyl-4-methylhexyl)-dimethylsilane |
| SMILES | CCCCCC1(C)CC[Si]1(C)OC(C)(CC)[Si](C)(C)CCCC(C)(CC)CC |
| InChI | InChI=1S/C25H54OSi2/c1-11-15-16-19-24(6)20-22-28(24,10)26-25(7,14-4)27(8,9)21-17-18-23(5,12-2)13-3/h11-22H2,1-10H3 |
| InChIKey | CYVXLEGVHZWUNT-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|