C19H44OSi2 — CID 123652125
2-dimethylsilylpropan-2-yloxy-dimethyl-(3,4,4,6,6-pentamethylheptan-3-yl)silane (PubChem CID 123652125) has the molecular formula C19H44OSi2 and a molecular weight of 344.73 g/mol. Its IUPAC name is 2-dimethylsilylpropan-2-yloxy-dimethyl-(3,4,4,6,6-pentamethylheptan-3-yl)silane.
| Compound Name | 2-dimethylsilylpropan-2-yloxy-dimethyl-(3,4,4,6,6-pentamethylheptan-3-yl)silane |
|---|---|
| PubChem CID | 123652125 |
| Molecular Formula | C19H44OSi2 |
| Molecular Weight | 344.73 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 2-dimethylsilylpropan-2-yloxy-dimethyl-(3,4,4,6,6-pentamethylheptan-3-yl)silane |
| SMILES | CCC(C)(C(C)(C)CC(C)(C)C)[Si](C)(C)OC(C)(C)[SiH](C)C |
| InChI | InChI=1S/C19H44OSi2/c1-14-19(9,17(5,6)15-16(2,3)4)22(12,13)20-18(7,8)21(10)11/h21H,14-15H2,1-13H3 |
| InChIKey | AFFMIQJGLPEMSD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.73 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|