C27H60OSi2 — CID 123582887
2-[dimethyl(2,3,3,5,5-pentamethylhexan-2-yl)silyl]oxybutan-2-yl-dimethyl-(2,4,4-trimethylpentan-2-yl)silane (PubChem CID 123582887) has the molecular formula C27H60OSi2 and a molecular weight of 456.95 g/mol. Its IUPAC name is 2-[dimethyl(2,3,3,5,5-pentamethylhexan-2-yl)silyl]oxybutan-2-yl-dimethyl-(2,4,4-trimethylpentan-2-yl)silane.
| Compound Name | 2-[dimethyl(2,3,3,5,5-pentamethylhexan-2-yl)silyl]oxybutan-2-yl-dimethyl-(2,4,4-trimethylpentan-2-yl)silane |
|---|---|
| PubChem CID | 123582887 |
| Molecular Formula | C27H60OSi2 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | 2-[dimethyl(2,3,3,5,5-pentamethylhexan-2-yl)silyl]oxybutan-2-yl-dimethyl-(2,4,4-trimethylpentan-2-yl)silane |
| SMILES | CCC(C)(O[Si](C)(C)C(C)(C)C(C)(C)CC(C)(C)C)[Si](C)(C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H60OSi2/c1-19-27(14,29(15,16)25(10,11)21-23(5,6)7)28-30(17,18)26(12,13)24(8,9)20-22(2,3)4/h19-21H2,1-18H3 |
| InChIKey | MBPYMLWREXMGPL-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|