C20H46OSi2 — CID 123418177
(2-tert-butyl-2,4,4-trimethylhexyl)-dimethyl-(2-trimethylsilyloxyethyl)silane (PubChem CID 123418177) has the molecular formula C20H46OSi2 and a molecular weight of 358.76 g/mol. Its IUPAC name is (2-tert-butyl-2,4,4-trimethylhexyl)-dimethyl-(2-trimethylsilyloxyethyl)silane.
| Compound Name | (2-tert-butyl-2,4,4-trimethylhexyl)-dimethyl-(2-trimethylsilyloxyethyl)silane |
|---|---|
| PubChem CID | 123418177 |
| Molecular Formula | C20H46OSi2 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | (2-tert-butyl-2,4,4-trimethylhexyl)-dimethyl-(2-trimethylsilyloxyethyl)silane |
| SMILES | CCC(C)(C)CC(C)(C[Si](C)(C)CCO[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H46OSi2/c1-13-19(5,6)16-20(7,18(2,3)4)17-23(11,12)15-14-21-22(8,9)10/h13-17H2,1-12H3 |
| InChIKey | BHTZDXOVTAZTDO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|