C16H38OSi2 — CID 90751903
dimethyl-(2,2,5,5-tetramethylheptan-3-yl)-trimethylsilyloxysilane (PubChem CID 90751903) has the molecular formula C16H38OSi2 and a molecular weight of 302.65 g/mol. Its IUPAC name is dimethyl-(2,2,5,5-tetramethylheptan-3-yl)-trimethylsilyloxysilane.
| Compound Name | dimethyl-(2,2,5,5-tetramethylheptan-3-yl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 90751903 |
| Molecular Formula | C16H38OSi2 |
| Molecular Weight | 302.65 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | dimethyl-(2,2,5,5-tetramethylheptan-3-yl)-trimethylsilyloxysilane |
| SMILES | CCC(C)(C)CC(C(C)(C)C)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H38OSi2/c1-12-16(5,6)13-14(15(2,3)4)19(10,11)17-18(7,8)9/h14H,12-13H2,1-11H3 |
| InChIKey | MDXFJBIKELETHL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|