C21H46OSi — CID 123525516
2,2,3,5,6,7,7-heptamethyloctan-4-yl-dimethyl-[(2-methylpropan-2-yl)oxy]silane (PubChem CID 123525516) has the molecular formula C21H46OSi and a molecular weight of 342.68 g/mol. Its IUPAC name is 2,2,3,5,6,7,7-heptamethyloctan-4-yl-dimethyl-[(2-methylpropan-2-yl)oxy]silane.
| Compound Name | 2,2,3,5,6,7,7-heptamethyloctan-4-yl-dimethyl-[(2-methylpropan-2-yl)oxy]silane |
|---|---|
| PubChem CID | 123525516 |
| Molecular Formula | C21H46OSi |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | 2,2,3,5,6,7,7-heptamethyloctan-4-yl-dimethyl-[(2-methylpropan-2-yl)oxy]silane |
| SMILES | CC(C(C)C(C)(C)C)C(C(C)C(C)(C)C)[Si](C)(C)OC(C)(C)C |
| InChI | InChI=1S/C21H46OSi/c1-15(16(2)19(4,5)6)18(17(3)20(7,8)9)23(13,14)22-21(10,11)12/h15-18H,1-14H3 |
| InChIKey | ACZKHTZGNXZNNW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|