C28H43N3O8 — CID 90898102
5-O-tert-butyl 1-O-ethyl (2S)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-2-(4-phenylmethoxycarbonylpiperazin-1-yl)pentanedioate (PubChem CID 90898102) has the molecular formula C28H43N3O8 and a molecular weight of 549.67 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl (2S)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-2-(4-phenylmethoxycarbonylpiperazin-1-yl)pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-ethyl (2S)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-2-(4-phenylmethoxycarbonylpiperazin-1-yl)pentanedioate |
|---|---|
| PubChem CID | 90898102 |
| Molecular Formula | C28H43N3O8 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl (2S)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-2-(4-phenylmethoxycarbonylpiperazin-1-yl)pentanedioate |
| SMILES | CCOC(=O)[C@@](CCC(=O)OC(C)(C)C)(N1CCN(C(=O)OCc2ccccc2)CC1)N(C=O)OC(C)(C)C |
| InChI | InChI=1S/C28H43N3O8/c1-8-36-24(34)28(31(21-32)39-27(5,6)7,15-14-23(33)38-26(2,3)4)30-18-16-29(17-19-30)25(35)37-20-22-12-10-9-11-13-22/h9-13,21H,8,14-20H2,1-7H3/t28-/m0/s1 |
| InChIKey | GMWOSSYJRMNIDO-NDEPHWFRSA-N |
| XLogP | 3.51 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|