C36H46NO5S+ — CID 90899108
6-[2-[5-(1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-5-sulfo-1H-inden-1-yl]hexanoic acid (PubChem CID 90899108) has the molecular formula C36H46NO5S+ and a molecular weight of 604.83 g/mol. Its IUPAC name is 6-[2-[5-(1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-5-sulfo-1H-inden-1-yl]hexanoic acid.
| Compound Name | 6-[2-[5-(1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-5-sulfo-1H-inden-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 90899108 |
| Molecular Formula | C36H46NO5S+ |
| Molecular Weight | 604.83 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | 6-[2-[5-(1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-3,3-dimethyl-5-sulfo-1H-inden-1-yl]hexanoic acid |
| SMILES | CCCC[N+]1=C(C=CC=CC=C2C(CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H45NO5S/c1-6-7-24-37-32-19-15-14-18-30(32)36(4,5)33(37)20-12-9-11-17-29-27(16-10-8-13-21-34(38)39)28-23-22-26(43(40,41)42)25-31(28)35(29,2)3/h9,11-12,14-15,17-20,22-23,25,27H,6-8,10,13,16,21,24H2,1-5H3,(H-,38,39,40,41,42)/p+1 |
| InChIKey | RFTMJMWQVQEQPL-UHFFFAOYSA-O |
| XLogP | 8.26 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.83 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|