C42H55N2O10S2+ — CID 158168530
6-[4,6-di(butanoyl)-2-[5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid (PubChem CID 158168530) has the molecular formula C42H55N2O10S2+ and a molecular weight of 812.04 g/mol. Its IUPAC name is 6-[4,6-di(butanoyl)-2-[5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid.
| Compound Name | 6-[4,6-di(butanoyl)-2-[5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 158168530 |
| Molecular Formula | C42H55N2O10S2+ |
| Molecular Weight | 812.04 g/mol |
| Exact Mass | 811.33 |
| IUPAC Name | 6-[4,6-di(butanoyl)-2-[5-[3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
| SMILES | CCCC(=O)c1cc(C(=O)CCC)c2c(c1)N(CCCCCC(=O)O)C(=CC=CC=CC1=[N+](CCCS(=O)(=O)O)c3ccc(S(=O)(=O)O)cc3C1(C)C)C2(C)C |
| InChI | InChI=1S/C42H54N2O10S2/c1-7-16-35(45)29-26-31(36(46)17-8-2)40-34(27-29)44(23-14-10-13-20-39(47)48)38(42(40,5)6)19-12-9-11-18-37-41(3,4)32-28-30(56(52,53)54)21-22-33(32)43(37)24-15-25-55(49,50)51/h9,11-12,18-19,21-22,26-28H,7-8,10,13-17,20,23-25H2,1-6H3,(H2-,47,48,49,50,51,52,53,54)/p+1 |
| InChIKey | YSMDXLWRKPXDBG-UHFFFAOYSA-O |
| XLogP | 7.99 |
| TPSA | 186.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.04 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|