C33H43FN2O2Si2 — CID 90901338
3-[(4-fluorophenyl)methyl]-7-methyl-5-(2-trimethylsilylethynyl)-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol (PubChem CID 90901338) has the molecular formula C33H43FN2O2Si2 and a molecular weight of 574.89 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-methyl-5-(2-trimethylsilylethynyl)-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-(2-trimethylsilylethynyl)-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
|---|---|
| PubChem CID | 90901338 |
| Molecular Formula | C33H43FN2O2Si2 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-(2-trimethylsilylethynyl)-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-8-ol |
| SMILES | CC(C)[Si](Oc1c2ncc(Cc3ccc(F)cc3)cc2c(C#C[Si](C)(C)C)c2cn(C)c(O)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H43FN2O2Si2/c1-21(2)40(22(3)4,23(5)6)38-32-30-29(20-36(7)33(30)37)27(15-16-39(8,9)10)28-18-25(19-35-31(28)32)17-24-11-13-26(34)14-12-24/h11-14,18-23,37H,17H2,1-10H3 |
| InChIKey | RJOQHHSRADNILJ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|