C19H27N3O8S3 — CID 90919519
2-(methanesulfonamido)-N-(1,2,3,4,5-pentahydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 90919519) has the molecular formula C19H27N3O8S3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N-(1,2,3,4,5-pentahydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(methanesulfonamido)-N-(1,2,3,4,5-pentahydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90919519 |
| Molecular Formula | C19H27N3O8S3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 2-(methanesulfonamido)-N-(1,2,3,4,5-pentahydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CSCCC(O)C(O)C(O)C(O)(NC(=O)c1csc(NS(C)(=O)=O)n1)C(O)c1ccccc1 |
| InChI | InChI=1S/C19H27N3O8S3/c1-31-9-8-13(23)14(24)16(26)19(28,15(25)11-6-4-3-5-7-11)21-17(27)12-10-32-18(20-12)22-33(2,29)30/h3-7,10,13-16,23-26,28H,8-9H2,1-2H3,(H,20,22)(H,21,27) |
| InChIKey | PUFNNWMNJJEXAY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 189.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|