C34H28N2O2S3 — CID 90920189
5-[6-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)hexa-1,2,4-trienyl]-4-hydroxy-3-(2-naphthalen-1-yloxyethyl)-1,3-thiazole-2-thione (PubChem CID 90920189) has the molecular formula C34H28N2O2S3 and a molecular weight of 592.81 g/mol. Its IUPAC name is 5-[6-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)hexa-1,2,4-trienyl]-4-hydroxy-3-(2-naphthalen-1-yloxyethyl)-1,3-thiazole-2-thione.
| Compound Name | 5-[6-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)hexa-1,2,4-trienyl]-4-hydroxy-3-(2-naphthalen-1-yloxyethyl)-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 90920189 |
| Molecular Formula | C34H28N2O2S3 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | 5-[6-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)hexa-1,2,4-trienyl]-4-hydroxy-3-(2-naphthalen-1-yloxyethyl)-1,3-thiazole-2-thione |
| SMILES | CCN1C(=CC=CC=C=Cc2sc(=S)n(CCOc3cccc4ccccc34)c2O)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C34H28N2O2S3/c1-2-35-28-21-20-25-13-8-10-16-27(25)32(28)41-31(35)19-6-4-3-5-18-30-33(37)36(34(39)40-30)22-23-38-29-17-11-14-24-12-7-9-15-26(24)29/h3-4,6-21,37H,2,22-23H2,1H3 |
| InChIKey | FCDPEMOBXFQSFZ-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|