C17H22 — CID 90920629
spiro[2,4,4a,4b,5,6-hexahydro-1H-phenanthrene-3,1'-cyclobutane] (PubChem CID 90920629) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is spiro[2,4,4a,4b,5,6-hexahydro-1H-phenanthrene-3,1'-cyclobutane].
| Compound Name | spiro[2,4,4a,4b,5,6-hexahydro-1H-phenanthrene-3,1'-cyclobutane] |
|---|---|
| PubChem CID | 90920629 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | spiro[2,4,4a,4b,5,6-hexahydro-1H-phenanthrene-3,1'-cyclobutane] |
| SMILES | C1=CC2=CC=C3CCC4(CCC4)CC3C2CC1 |
| InChI | InChI=1S/C17H22/c1-2-5-15-13(4-1)6-7-14-8-11-17(9-3-10-17)12-16(14)15/h1,4,6-7,15-16H,2-3,5,8-12H2 |
| InChIKey | XTVRCCSWDRYRAF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |