C10H12F2 — CID 145389502
1,3-difluoro-1,2,3,7,8,8a-hexahydronaphthalene (PubChem CID 145389502) has the molecular formula C10H12F2 and a molecular weight of 170.20 g/mol. Its IUPAC name is 1,3-difluoro-1,2,3,7,8,8a-hexahydronaphthalene.
| Compound Name | 1,3-difluoro-1,2,3,7,8,8a-hexahydronaphthalene |
|---|---|
| PubChem CID | 145389502 |
| Molecular Formula | C10H12F2 |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1,3-difluoro-1,2,3,7,8,8a-hexahydronaphthalene |
| SMILES | FC1C=C2C=CCCC2C(F)C1 |
| InChI | InChI=1S/C10H12F2/c11-8-5-7-3-1-2-4-9(7)10(12)6-8/h1,3,5,8-10H,2,4,6H2 |
| InChIKey | PQFSVOAWPZZYHN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |