C24H31ClN3O3+ — CID 90923938
3-[[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]methyl]-3-ethyl-1H-benzimidazol-3-ium-2-one (PubChem CID 90923938) has the molecular formula C24H31ClN3O3+ and a molecular weight of 444.98 g/mol. Its IUPAC name is 3-[[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]methyl]-3-ethyl-1H-benzimidazol-3-ium-2-one.
| Compound Name | 3-[[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]methyl]-3-ethyl-1H-benzimidazol-3-ium-2-one |
|---|---|
| PubChem CID | 90923938 |
| Molecular Formula | C24H31ClN3O3+ |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[[1-[3-(4-chlorophenoxy)-2-hydroxypropyl]piperidin-4-yl]methyl]-3-ethyl-1H-benzimidazol-3-ium-2-one |
| SMILES | CC[N+]1(CC2CCN(CC(O)COc3ccc(Cl)cc3)CC2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C24H30ClN3O3/c1-2-28(23-6-4-3-5-22(23)26-24(28)30)16-18-11-13-27(14-12-18)15-20(29)17-31-21-9-7-19(25)8-10-21/h3-10,18,20,29H,2,11-17H2,1H3/p+1 |
| InChIKey | UJCBANPBTKZCBH-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|