C16H12ClN5O3S — CID 90925686
[2-chloro-4-[5-cyano-2-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]sulfamic acid (PubChem CID 90925686) has the molecular formula C16H12ClN5O3S and a molecular weight of 389.82 g/mol. Its IUPAC name is [2-chloro-4-[5-cyano-2-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]sulfamic acid.
| Compound Name | [2-chloro-4-[5-cyano-2-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 90925686 |
| Molecular Formula | C16H12ClN5O3S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [2-chloro-4-[5-cyano-2-(1,2,4-triazol-1-ylmethyl)phenyl]phenyl]sulfamic acid |
| SMILES | N#Cc1ccc(Cn2cncn2)c(-c2ccc(NS(=O)(=O)O)c(Cl)c2)c1 |
| InChI | InChI=1S/C16H12ClN5O3S/c17-15-6-12(3-4-16(15)21-26(23,24)25)14-5-11(7-18)1-2-13(14)8-22-10-19-9-20-22/h1-6,9-10,21H,8H2,(H,23,24,25) |
| InChIKey | ZNZRALOKTVCIGU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|