C43H41Cl4N7O7 — CID 90928043
tert-butyl [1-[5-(dimethylcarbamoyl)benzotriazol-2-yl]naphthalen-2-yl] carbonate;tert-butyl [2,3,4,5-tetrachloro-6-(5,6-dimethylbenzotriazol-2-yl)phenyl] carbonate (PubChem CID 90928043) has the molecular formula C43H41Cl4N7O7 and a molecular weight of 909.65 g/mol. Its IUPAC name is tert-butyl [1-[5-(dimethylcarbamoyl)benzotriazol-2-yl]naphthalen-2-yl] carbonate;tert-butyl [2,3,4,5-tetrachloro-6-(5,6-dimethylbenzotriazol-2-yl)phenyl] carbonate.
| Compound Name | tert-butyl [1-[5-(dimethylcarbamoyl)benzotriazol-2-yl]naphthalen-2-yl] carbonate;tert-butyl [2,3,4,5-tetrachloro-6-(5,6-dimethylbenzotriazol-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 90928043 |
| Molecular Formula | C43H41Cl4N7O7 |
| Molecular Weight | 909.65 g/mol |
| Exact Mass | 907.18 |
| IUPAC Name | tert-butyl [1-[5-(dimethylcarbamoyl)benzotriazol-2-yl]naphthalen-2-yl] carbonate;tert-butyl [2,3,4,5-tetrachloro-6-(5,6-dimethylbenzotriazol-2-yl)phenyl] carbonate |
| SMILES | CN(C)C(=O)c1ccc2nn(-c3c(OC(=O)OC(C)(C)C)ccc4ccccc34)nc2c1.Cc1cc2nn(-c3c(Cl)c(Cl)c(Cl)c(Cl)c3OC(=O)OC(C)(C)C)nc2cc1C |
| InChI | InChI=1S/C24H24N4O4.C19H17Cl4N3O3/c1-24(2,3)32-23(30)31-20-13-11-15-8-6-7-9-17(15)21(20)28-25-18-12-10-16(14-19(18)26-28)22(29)27(4)5;1-8-6-10-11(7-9(8)2)25-26(24-10)16-14(22)12(20)13(21)15(23)17(16)28-18(27)29-19(3,4)5/h6-14H,1-5H3;6-7H,1-5H3 |
| InChIKey | KITUKBDYLWORDC-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 152.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.65 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|