C10H15FN5O6P — CID 90928342
4-amino-1-[(2R,3R,4R,5R)-5-(2-diaminooxyphosphorylethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 90928342) has the molecular formula C10H15FN5O6P and a molecular weight of 351.23 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-5-(2-diaminooxyphosphorylethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-5-(2-diaminooxyphosphorylethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 90928342 |
| Molecular Formula | C10H15FN5O6P |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-5-(2-diaminooxyphosphorylethenyl)-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | NOP(=O)(C=C[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O)ON |
| InChI | InChI=1S/C10H15FN5O6P/c11-7-8(17)5(2-4-23(19,21-13)22-14)20-9(7)16-3-1-6(12)15-10(16)18/h1-5,7-9,17H,13-14H2,(H2,12,15,18)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | ANAXLWBBADUMSN-ZOQUXTDFSA-N |
| XLogP | -1.09 |
| TPSA | 177.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|