C17H13ClF3N3O3 — CID 90928598
7-chloro-N',1-dihydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboximidamide (PubChem CID 90928598) has the molecular formula C17H13ClF3N3O3 and a molecular weight of 399.76 g/mol. Its IUPAC name is 7-chloro-N',1-dihydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboximidamide.
| Compound Name | 7-chloro-N',1-dihydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboximidamide |
|---|---|
| PubChem CID | 90928598 |
| Molecular Formula | C17H13ClF3N3O3 |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 7-chloro-N',1-dihydroxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboximidamide |
| SMILES | NC(=NO)c1cc(Cl)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C17H13ClF3N3O3/c18-13-6-10(15(22)23-26)5-11-8-24(16(25)14(11)13)7-9-1-3-12(4-2-9)27-17(19,20)21/h1-6,8,25-26H,7H2,(H2,22,23) |
| InChIKey | HEAPHDGFQVARIF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|