C44H34F3N3O10 — CID 90931177
[2,3,5-tribenzoyloxy-6-[5-(4-methoxyphenyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]oxan-4-yl] benzoate (PubChem CID 90931177) has the molecular formula C44H34F3N3O10 and a molecular weight of 821.76 g/mol. Its IUPAC name is [2,3,5-tribenzoyloxy-6-[5-(4-methoxyphenyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]oxan-4-yl] benzoate.
| Compound Name | [2,3,5-tribenzoyloxy-6-[5-(4-methoxyphenyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 90931177 |
| Molecular Formula | C44H34F3N3O10 |
| Molecular Weight | 821.76 g/mol |
| Exact Mass | 821.22 |
| IUPAC Name | [2,3,5-tribenzoyloxy-6-[5-(4-methoxyphenyl)-4-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]oxan-4-yl] benzoate |
| SMILES | COc1ccc(-c2nnc(C3OC(OC(=O)c4ccccc4)C(OC(=O)c4ccccc4)C(OC(=O)c4ccccc4)C3OC(=O)c3ccccc3)n2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C44H34F3N3O10/c1-55-32-24-22-27(23-25-32)37-48-49-38(50(37)26-44(45,46)47)35-33(56-39(51)28-14-6-2-7-15-28)34(57-40(52)29-16-8-3-9-17-29)36(58-41(53)30-18-10-4-11-19-30)43(59-35)60-42(54)31-20-12-5-13-21-31/h2-25,33-36,43H,26H2,1H3 |
| InChIKey | QVYCRONDJLWAHE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 154.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|