C30H38P2+2 — CID 90935111
(2R)-2-benzyl-1-[2-[(2R)-2-benzyl-1-methylphospholan-1-ium-1-yl]phenyl]-1-methylphospholan-1-ium (PubChem CID 90935111) has the molecular formula C30H38P2+2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (2R)-2-benzyl-1-[2-[(2R)-2-benzyl-1-methylphospholan-1-ium-1-yl]phenyl]-1-methylphospholan-1-ium.
| Compound Name | (2R)-2-benzyl-1-[2-[(2R)-2-benzyl-1-methylphospholan-1-ium-1-yl]phenyl]-1-methylphospholan-1-ium |
|---|---|
| PubChem CID | 90935111 |
| Molecular Formula | C30H38P2+2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (2R)-2-benzyl-1-[2-[(2R)-2-benzyl-1-methylphospholan-1-ium-1-yl]phenyl]-1-methylphospholan-1-ium |
| SMILES | C[P+]1(c2ccccc2[P+]2(C)CCC[C@@H]2Cc2ccccc2)CCC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H38P2/c1-31(21-11-17-27(31)23-25-13-5-3-6-14-25)29-19-9-10-20-30(29)32(2)22-12-18-28(32)24-26-15-7-4-8-16-26/h3-10,13-16,19-20,27-28H,11-12,17-18,21-24H2,1-2H3/q+2/t27-,28-,31?,32?/m1/s1 |
| InChIKey | DUFQBZPAKRZSSX-BONBFMHJSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|