C2H8O8P3+ — CID 90938318
CID 90938318 (PubChem CID 90938318) has the molecular formula C2H8O8P3+ and a molecular weight of 253.00 g/mol.
| Compound Name | CID 90938318 |
|---|---|
| PubChem CID | 90938318 |
| Molecular Formula | C2H8O8P3+ |
| Molecular Weight | 253.00 g/mol |
| Exact Mass | 252.94 |
| IUPAC Name | — |
| SMILES | O=P(=O)CC(P(=O)(O)O)[P+](O)(O)O |
| InChI | InChI=1S/C2H7O8P3/c3-11(4)1-2(12(5,6)7)13(8,9)10/h2,5-7H,1H2,(H-,8,9,10)/p+1 |
| InChIKey | RENPADNTGBUWCT-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.00 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|