C33H31N5 — CID 90944459
4-methylaniline;1-N-methyl-4-N-[4-[[4-(4-methylphenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]cyclohexa-2,5-diene-1,4-diimine (PubChem CID 90944459) has the molecular formula C33H31N5 and a molecular weight of 497.65 g/mol. Its IUPAC name is 4-methylaniline;1-N-methyl-4-N-[4-[[4-(4-methylphenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]cyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 4-methylaniline;1-N-methyl-4-N-[4-[[4-(4-methylphenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]cyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 90944459 |
| Molecular Formula | C33H31N5 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 4-methylaniline;1-N-methyl-4-N-[4-[[4-(4-methylphenyl)iminocyclohexa-2,5-dien-1-ylidene]amino]phenyl]cyclohexa-2,5-diene-1,4-diimine |
| SMILES | CN=C1C=CC(=Nc2ccc(N=C3C=CC(=Nc4ccc(C)cc4)C=C3)cc2)C=C1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C26H22N4.C7H9N/c1-19-3-5-21(6-4-19)28-23-11-13-25(14-12-23)30-26-17-15-24(16-18-26)29-22-9-7-20(27-2)8-10-22;1-6-2-4-7(8)5-3-6/h3-18H,1-2H3;2-5H,8H2,1H3/b27-20-,28-23-,29-22+,30-25+; |
| InChIKey | QXLMFCOKSQDDSC-JJJOTFAYSA-N |
| XLogP | 7.81 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|